(3-Chlorophenyl)(phenyl)methanamine hydrochloride, 98%
cas: 5267-37-8 — see every product listed under this CAS number, including other names
(3-Chlorophenyl)(phenyl)methanamine hydrochloride, 98% (CAS 5267-37-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A595357-250mg |
| cas | 5267-37-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 615.13 Pln | |
| Ambeed | 5g | 2784.50 Pln | |
| Ambeed | 25g | 13625.81 Pln | |
| BLDpharm | 100mg | 136.64 Pln | |
| BLDpharm | 250mg | 225.50 Pln | |
| BLDpharm | 1g | 658.68 Pln | |
| BLDpharm | 5g | 2996.75 Pln | |
| BLDpharm | 25g | 14687.08 Pln | |
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 482.00 Pln | |
| Chemat | 5g | 2162.00 Pln | |
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 211.40 Pln | |
| Fluorochem | 1g | 633.13 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(3-chlorophenyl)-phenylmethanamine;hydrochloride (CAS 5267-37-8) is a chemical compound with the molecular formula C13H13Cl2N and a molecular weight of 254.15 g/mol. IUPAC name: (3-chlorophenyl)-phenylmethanamine;hydrochloride. InChIKey: UCOACANPNQMECK-UHFFFAOYSA-N.
| Molecular formula | C13H13Cl2N |
|---|---|
| Molecular weight | 254.15 g/mol |
| IUPAC name | (3-chlorophenyl)-phenylmethanamine;hydrochloride |
| InChIKey | UCOACANPNQMECK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC(=CC=C2)Cl)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(3-chlorophenyl)(phenyl)methanamine hydrochloride, C-(3-Chloro-phenyl)-C-phenyl-methylamine hydrochloride, (3-Chlorophenyl)(phenyl)methanamine HCl, C13H13Cl2N, (3-chlorophenyl)-phenylmethanamine;hydrochloride, 7-methoxythiochroman-4-one 1,1-dioxide, (3-chlorophenyl)(phenyl)methanaminehydrochloride, (3-chlorophenyl)-phenyl-methanamine;hydrochloride, (3-Chlorophenyl)(phenyl)methanamine hydrochloride - [C89442], 1-(3-Chlorophenyl)-1-phenylmethanamine--hydrogen chloride (1/1)