cas: 949146-39-8 — see every product listed under this CAS number, including other names
(3-Fluoro-2,4-dimethoxyphenyl)boronic acid 98% (CAS 949146-39-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A238587-250mg |
| cas | 949146-39-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 698.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A238587 |
(3-fluoro-2,4-dimethoxyphenyl)boronic acid (CAS 949146-39-8) is a chemical compound with the molecular formula C8H10BFO4 and a molecular weight of 199.97 g/mol. IUPAC name: (3-fluoro-2,4-dimethoxyphenyl)boronic acid. InChIKey: BISXERIORTWMKJ-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO4 |
|---|---|
| Molecular weight | 199.97 g/mol |
| IUPAC name | (3-fluoro-2,4-dimethoxyphenyl)boronic acid |
| InChIKey | BISXERIORTWMKJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OC)F)OC)(O)O |
Computed by PubChem (NCBI)