(4'-Methyl-[1,1'-biphenyl]-4-yl)boronic acid, 97%
cas: 393870-04-7 — see every product listed under this CAS number, including other names
(4'-Methyl-[1,1'-biphenyl]-4-yl)boronic acid, 97% (CAS 393870-04-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 250mg. Offered by: Ambeed, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A242390-1g |
| cas | 393870-04-7 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 309.19 Pln | |
| Ambeed | 25g | 809.81 Pln | |
| Ambeed | 100g | 2784.50 Pln | |
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 268.67 Pln | |
| Fluorochem | 25g | 830.98 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 325.47 Pln | |
| BLDpharm | 25g | 869.72 Pln | |
| BLDpharm | 100g | 2730.17 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
[4-(4-methylphenyl)phenyl]boronic acid (CAS 393870-04-7) is a chemical compound with the molecular formula C13H13BO2 and a molecular weight of 212.05 g/mol. IUPAC name: [4-(4-methylphenyl)phenyl]boronic acid. InChIKey: UVCRLTMCDUXFSL-UHFFFAOYSA-N.
| Molecular formula | C13H13BO2 |
|---|---|
| Molecular weight | 212.05 g/mol |
| IUPAC name | [4-(4-methylphenyl)phenyl]boronic acid |
| InChIKey | UVCRLTMCDUXFSL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4'-Methyl-4-biphenylboronic Acid (contains varying amounts of Anhydride), (4'-Methyl-[1,1'-biphenyl]-4-yl)boronic acid, [4-(4-Methylphenyl)phenyl]boronic acid, Boronic acid,(4'-methyl[1,1'-biphenyl]-4-yl)-, Boronic acid, (4'-methyl[1,1'-biphenyl]-4-yl)-, Boronicacid,(4'-methyl[1,1'-biphenyl]-4-yl)-, [4-(p-tolyl)phenyl]boronic acid, 4'-methyl[1,1'-biphenyl]-4-ylboronic acid, (4'-Methyl-[1,1'-biphenyl]-4-yl)boronicacid, (4'-Methyl[1,1'-biphenyl]-4-yl)boronic acid