CAS 1029439-30-2 appears in our catalog under these names: 3-Methyl-4-phenylphenylboronic acid, 95%, (2-Methyl-(1,1'-biphenyl)-4-yl)boronic acid, 98%, (3-methyl-4-phenylphenyl)boronic acid, ≥95%, ≥95%, 3-Methyl-4-phenylphenylboronic acid, ≥95%, (2-Methyl-[1,1'-biphenyl]-4-yl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
(3-methyl-4-phenylphenyl)boronic acid (CAS 1029439-30-2) is a chemical compound with the molecular formula C13H13BO2 and a molecular weight of 212.05 g/mol. IUPAC name: (3-methyl-4-phenylphenyl)boronic acid. InChIKey: FVHZTYOYTDWLFT-UHFFFAOYSA-N.
| Molecular formula | C13H13BO2 |
|---|---|
| Molecular weight | 212.05 g/mol |
| IUPAC name | (3-methyl-4-phenylphenyl)boronic acid |
| InChIKey | FVHZTYOYTDWLFT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C2=CC=CC=C2)C)(O)O |
Computed by PubChem (NCBI)