Products 393870-04-7
CAS 393870-04-7 appears in our catalog under these names: 4'–Methyl–4–biphenylboronic Acid (contains varying amounts of Anhydride), 4'-Methyl-4-biphenylboronic Acid (contains varying amounts of Anhydride), [4-(4-Methylphenyl)phenyl]boronic acid, 97%, 97%, (4'-Methyl-[1,1'-biphenyl]-4-yl)boronic acid, 97%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 1g, 250mg, 100g.
[4-(4-methylphenyl)phenyl]boronic acid (CAS 393870-04-7) is a chemical compound with the molecular formula C13H13BO2 and a molecular weight of 212.05 g/mol. IUPAC name: [4-(4-methylphenyl)phenyl]boronic acid. InChIKey: UVCRLTMCDUXFSL-UHFFFAOYSA-N.
| Molecular formula | C13H13BO2 |
|---|---|
| Molecular weight | 212.05 g/mol |
| IUPAC name | [4-(4-methylphenyl)phenyl]boronic acid |
| InChIKey | UVCRLTMCDUXFSL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4'-Methyl-4-biphenylboronic Acid (contains varying amounts of Anhydride), (4'-Methyl-[1,1'-biphenyl]-4-yl)boronic acid, [4-(4-Methylphenyl)phenyl]boronic acid, Boronic acid,(4'-methyl[1,1'-biphenyl]-4-yl)-, Boronic acid, (4'-methyl[1,1'-biphenyl]-4-yl)-, Boronicacid,(4'-methyl[1,1'-biphenyl]-4-yl)-, [4-(p-tolyl)phenyl]boronic acid, 4'-methyl[1,1'-biphenyl]-4-ylboronic acid, (4'-Methyl-[1,1'-biphenyl]-4-yl)boronicacid, (4'-Methyl[1,1'-biphenyl]-4-yl)boronic acid