Products 1293362-78-3
CAS 1293362-78-3 appears in our catalog under these names: 4-Methyl-3-phenylbenzenboronic acid, 4-Methyl-3-phenylbenzenboronic acid, 95%, (6-Methyl-(1,1'-biphenyl)-3-yl)boronic acid, 98%, (6-Methyl-[1,1'-biphenyl]-3-yl)boronic acid, ≥95%, ≥95%. Offered by: Fluorochem, Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg.
(4-methyl-3-phenylphenyl)boronic acid (CAS 1293362-78-3) is a chemical compound with the molecular formula C13H13BO2 and a molecular weight of 212.05 g/mol. IUPAC name: (4-methyl-3-phenylphenyl)boronic acid. InChIKey: HGJRATBOKHZFNC-UHFFFAOYSA-N.
| Molecular formula | C13H13BO2 |
|---|---|
| Molecular weight | 212.05 g/mol |
| IUPAC name | (4-methyl-3-phenylphenyl)boronic acid |
| InChIKey | HGJRATBOKHZFNC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C)C2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)