CAS 56311-13-8 appears in our catalog under these names: 4-(Phenylmethyl)phenylboronic acid, 96%, 4-(Phenylmethyl)phenylboronic acid, 98%, 98%, (4-Benzylphenyl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
(4-benzylphenyl)boronic acid (CAS 56311-13-8) is a chemical compound with the molecular formula C13H13BO2 and a molecular weight of 212.05 g/mol. IUPAC name: (4-benzylphenyl)boronic acid. InChIKey: LPXRLRBXBWDOPK-UHFFFAOYSA-N.
| Molecular formula | C13H13BO2 |
|---|---|
| Molecular weight | 212.05 g/mol |
| IUPAC name | (4-benzylphenyl)boronic acid |
| InChIKey | LPXRLRBXBWDOPK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)