Products 1438810-09-3
CAS 1438810-09-3 appears in our catalog under these names: 4-Methylbiphenyl-3-ylboronic acid, 4-Methylbiphenyl-3-ylboronic acid, 95%, (4-Methyl-(1,1'-biphenyl)-3-yl)boronic acid, 98%, (4-Methyl-[1,1'-biphenyl]-3-yl)boronic acid, ≥95%, ≥95%. Offered by: Fluorochem, Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
(2-methyl-5-phenylphenyl)boronic acid (CAS 1438810-09-3) is a chemical compound with the molecular formula C13H13BO2 and a molecular weight of 212.05 g/mol. IUPAC name: (2-methyl-5-phenylphenyl)boronic acid. InChIKey: NMHLASMALNJICM-UHFFFAOYSA-N.
| Molecular formula | C13H13BO2 |
|---|---|
| Molecular weight | 212.05 g/mol |
| IUPAC name | (2-methyl-5-phenylphenyl)boronic acid |
| InChIKey | NMHLASMALNJICM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C2=CC=CC=C2)C)(O)O |
Computed by PubChem (NCBI)