CAS 491595-36-9 appears in our catalog under these names: (4-(2-Methylphenyl)phenyl)boronic acid, 95-<97%, (2'–Methyl–(1,1'–biphenyl)–4–yl)boronic acid, 4-(2-Methylphenyl)phenylboronic acid, 4-(2-METHYLPHENYL)PHENYLBORONIC ACID, 95%, 95%, (2'-Methyl-[1,1'-biphenyl]-4-yl)boronic acid, 95%. Offered by: Hoffman Fine Chemicals, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g, 100mg, 250mg.
[4-(2-methylphenyl)phenyl]boronic acid (CAS 491595-36-9) is a chemical compound with the molecular formula C13H13BO2 and a molecular weight of 212.05 g/mol. IUPAC name: [4-(2-methylphenyl)phenyl]boronic acid. InChIKey: ZBZVBPYIBOLGCU-UHFFFAOYSA-N.
| Molecular formula | C13H13BO2 |
|---|---|
| Molecular weight | 212.05 g/mol |
| IUPAC name | [4-(2-methylphenyl)phenyl]boronic acid |
| InChIKey | ZBZVBPYIBOLGCU-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=CC=C2C)(O)O |
Computed by PubChem (NCBI)