CAS 173394-24-6 appears in our catalog under these names: (3-Benzylphenyl)boronic acid, 97%, 97%, (3-Benzylphenyl)boronic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(3-benzylphenyl)boronic acid (CAS 173394-24-6) is a chemical compound with the molecular formula C13H13BO2 and a molecular weight of 212.05 g/mol. IUPAC name: (3-benzylphenyl)boronic acid. InChIKey: ONYYAVJRRZKXDI-UHFFFAOYSA-N.
| Molecular formula | C13H13BO2 |
|---|---|
| Molecular weight | 212.05 g/mol |
| IUPAC name | (3-benzylphenyl)boronic acid |
| InChIKey | ONYYAVJRRZKXDI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)CC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)