CAS 501944-56-5 appears in our catalog under these names: 4-(3-Methylphenyl)phenylboronic acid, 97%, (3'-Methyl-[1,1'-biphenyl]-4-yl)boronic acid 97%, 4-(3-Methylphenyl)phenylboronic acid, 97%, 97%, (3'-Methyl-[1,1'-biphenyl]-4-yl)boronic acid. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g.
[4-(3-methylphenyl)phenyl]boronic acid (CAS 501944-56-5) is a chemical compound with the molecular formula C13H13BO2 and a molecular weight of 212.05 g/mol. IUPAC name: [4-(3-methylphenyl)phenyl]boronic acid. InChIKey: ZMAZTBOWJCUUAW-UHFFFAOYSA-N.
| Molecular formula | C13H13BO2 |
|---|---|
| Molecular weight | 212.05 g/mol |
| IUPAC name | [4-(3-methylphenyl)phenyl]boronic acid |
| InChIKey | ZMAZTBOWJCUUAW-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=CC(=C2)C)(O)O |
Computed by PubChem (NCBI)