cas: 1256354-93-4 — see every product listed under this CAS number, including other names
(4,5-Dichloro-2-methoxyphenyl)boronic acid 97% (CAS 1256354-93-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A438310-250mg |
| cas | 1256354-93-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 592.88 Pln | |
| Ambeed | 5g | 1905.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A438310 |
(4,5-dichloro-2-methoxyphenyl)boronic acid (CAS 1256354-93-4) is a chemical compound with the molecular formula C7H7BCl2O3 and a molecular weight of 220.84 g/mol. IUPAC name: (4,5-dichloro-2-methoxyphenyl)boronic acid. InChIKey: FLEKBCZAZMHPLQ-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O3 |
|---|---|
| Molecular weight | 220.84 g/mol |
| IUPAC name | (4,5-dichloro-2-methoxyphenyl)boronic acid |
| InChIKey | FLEKBCZAZMHPLQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1OC)Cl)Cl)(O)O |
Computed by PubChem (NCBI)