(4,5-Difluoro-2-methoxyphenyl)boronic acid, 98%
cas: 870777-32-5 — see every product listed under this CAS number, including other names
(4,5-Difluoro-2-methoxyphenyl)boronic acid, 98% (CAS 870777-32-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A370168-250mg |
| cas | 870777-32-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 153.44 Pln | |
| Ambeed | 5g | 353.69 Pln | |
| Ambeed | 10g | 637.38 Pln | |
| Ambeed | 25g | 1477.31 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 266.00 Pln | |
| Chemat | 10g | 458.00 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 158.86 Pln | |
| BLDpharm | 5g | 364.34 Pln | |
| BLDpharm | 10g | 653.13 Pln | |
| BLDpharm | 25g | 1519.49 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(4,5-difluoro-2-methoxyphenyl)boronic acid (CAS 870777-32-5) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: (4,5-difluoro-2-methoxyphenyl)boronic acid. InChIKey: ISQCHQGYKNHYGP-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | (4,5-difluoro-2-methoxyphenyl)boronic acid |
| InChIKey | ISQCHQGYKNHYGP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1OC)F)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4,5-Difluoro-2-methoxyphenyl)boronic acid, 4,5-Difluoro-2-methoxyphenylboronic acid, 4,5-Difluoro-2-methoxybenzeneboronic acid, (4,5-Difluoro-2-methoxyphenyl)boronicacid, (4,5-Difluoro-2-methoxy-phenyl)boronic acid, 4,5-difluoro-2-methoxy phenylboronic acid, 4,5-Difluoro-2-methoxyphenyl-boronic acid, 4,5-Difluoro-2-methoxyphenylboronic acid(contains varying amounts of Anhydride)