Products 870777-32-5
CAS 870777-32-5 appears in our catalog under these names: 4,5–Difluoro–2–methoxyphenylboronic acid(contains varying amounts of Anhydride), (4,5-Difluoro-2-methoxyphenyl)boronic acid, 98%, 98%, (4,5-Difluoro-2-methoxyphenyl)boronic acid, 95%, (4,5-Difluoro-2-methoxyphenyl)boronic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
(4,5-difluoro-2-methoxyphenyl)boronic acid (CAS 870777-32-5) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: (4,5-difluoro-2-methoxyphenyl)boronic acid. InChIKey: ISQCHQGYKNHYGP-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | (4,5-difluoro-2-methoxyphenyl)boronic acid |
| InChIKey | ISQCHQGYKNHYGP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1OC)F)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4,5-Difluoro-2-methoxyphenyl)boronic acid, 4,5-Difluoro-2-methoxyphenylboronic acid, 4,5-Difluoro-2-methoxybenzeneboronic acid, (4,5-Difluoro-2-methoxyphenyl)boronicacid, (4,5-Difluoro-2-methoxy-phenyl)boronic acid, 4,5-difluoro-2-methoxy phenylboronic acid, 4,5-Difluoro-2-methoxyphenyl-boronic acid, 4,5-Difluoro-2-methoxyphenylboronic acid(contains varying amounts of Anhydride)