cas: 865360-61-8 — see every product listed under this CAS number, including other names
(4-(4,4-dimethylcyclohexyl)phenyl)boronic acid, ≥95%, ≥95% (CAS 865360-61-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DD1V-1g |
| cas | 865360-61-8 |
| size | 1g |
| availability | 14g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 4173.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
[4-(4,4-dimethylcyclohexyl)phenyl]boronic acid (CAS 865360-61-8) is a chemical compound with the molecular formula C14H21BO2 and a molecular weight of 232.13 g/mol. IUPAC name: [4-(4,4-dimethylcyclohexyl)phenyl]boronic acid. InChIKey: KRMIWWSLZCKLRQ-UHFFFAOYSA-N.
| Molecular formula | C14H21BO2 |
|---|---|
| Molecular weight | 232.13 g/mol |
| IUPAC name | [4-(4,4-dimethylcyclohexyl)phenyl]boronic acid |
| InChIKey | KRMIWWSLZCKLRQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2CCC(CC2)(C)C)(O)O |
Computed by PubChem (NCBI)