Products 1075719-83-3
CAS 1075719-83-3 appears in our catalog under these names: 3-Ethylphenylboronic acid pinacol ester, 2-(3-ethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 2-(3-Ethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95+%. Offered by: Biosynth, Combi-blocks, Fluorochem. Available pack sizes: 2,5g, 5g, 1g, 250mg.
2-(3-ethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1075719-83-3) is a chemical compound with the molecular formula C14H21BO2 and a molecular weight of 232.13 g/mol. IUPAC name: 2-(3-ethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HGQJLAFYLXBEMB-UHFFFAOYSA-N.
| Molecular formula | C14H21BO2 |
|---|---|
| Molecular weight | 232.13 g/mol |
| IUPAC name | 2-(3-ethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HGQJLAFYLXBEMB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)CC |
Computed by PubChem (NCBI)