CAS 390381-02-9 appears in our catalog under these names: 2-Methylbenzylboronic acid pinacol ester, 96%, 4,4,5,5-Tetramethyl-2-(2-methylbenzyl)-1,3,2-dioxaborolane, 98%, 4,4,5,5–Tetramethyl–2–(2–methylbenzyl)–1,3,2–dioxaborolane. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 1g, 10g, 100mg.
4,4,5,5-tetramethyl-2-[(2-methylphenyl)methyl]-1,3,2-dioxaborolane (CAS 390381-02-9) is a chemical compound with the molecular formula C14H21BO2 and a molecular weight of 232.13 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[(2-methylphenyl)methyl]-1,3,2-dioxaborolane. InChIKey: FXACVPIKPLPIBV-UHFFFAOYSA-N.
| Molecular formula | C14H21BO2 |
|---|---|
| Molecular weight | 232.13 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[(2-methylphenyl)methyl]-1,3,2-dioxaborolane |
| InChIKey | FXACVPIKPLPIBV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2=CC=CC=C2C |
Computed by PubChem (NCBI)