CAS 365564-12-1 appears in our catalog under these names: 3-methylbenzylboronic acid pinacol ester, 96%, 4,4,5,5-Tetramethyl-2-(3-methylbenzyl)-1,3,2-dioxaborolane, 98%, 3-methylbenzylboronic acid pinacol ester, 3-methylbenzylboronic acid pinacol ester, 97%, 97%, 4,4,5,5-TETRAMETHYL-2-[(3-METHYLPHENYL)METHYL]-1,3,2-DIOXABOROLANE, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
4,4,5,5-tetramethyl-2-[(3-methylphenyl)methyl]-1,3,2-dioxaborolane (CAS 365564-12-1) is a chemical compound with the molecular formula C14H21BO2 and a molecular weight of 232.13 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[(3-methylphenyl)methyl]-1,3,2-dioxaborolane. InChIKey: UWLGHSSTOZFXKK-UHFFFAOYSA-N.
| Molecular formula | C14H21BO2 |
|---|---|
| Molecular weight | 232.13 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[(3-methylphenyl)methyl]-1,3,2-dioxaborolane |
| InChIKey | UWLGHSSTOZFXKK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2=CC=CC(=C2)C |
Computed by PubChem (NCBI)