(4-Cyanophenyl)methanesulfonyl chloride, 98%
cas: 56105-99-8 — see every product listed under this CAS number, including other names
(4-Cyanophenyl)methanesulfonyl chloride, 98% (CAS 56105-99-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A846005-100mg |
| cas | 56105-99-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 548.38 Pln | |
| Ambeed | 5g | 1816.62 Pln | |
| BLDpharm | 100mg | 297.70 Pln | |
| BLDpharm | 250mg | 342.13 Pln | |
| BLDpharm | 1g | 580.93 Pln | |
| BLDpharm | 5g | 1952.67 Pln | |
| Chemat | 100mg | 352.40 Pln | |
| Chemat | 250mg | 496.40 Pln | |
| Chemat | 1g | 962.00 Pln | |
| Chemat | 5g | 2776.40 Pln | |
| Fluorochem | 250mg | 903.87 Pln | |
| Fluorochem | 1g | 1778.56 Pln | |
| Fluorochem | 5g | 5141.96 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(4-cyanophenyl)methanesulfonyl chloride (CAS 56105-99-8) is a chemical compound with the molecular formula C8H6ClNO2S and a molecular weight of 215.66 g/mol. IUPAC name: (4-cyanophenyl)methanesulfonyl chloride. InChIKey: UKKQISHRHXSEGI-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2S |
|---|---|
| Molecular weight | 215.66 g/mol |
| IUPAC name | (4-cyanophenyl)methanesulfonyl chloride |
| InChIKey | UKKQISHRHXSEGI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CS(=O)(=O)Cl)C#N |
Computed by PubChem (NCBI)
Synonyms:
(4-cyanophenyl)methanesulfonyl chloride, (4-Cyanophenyl)methanesulfonylchloride, 4-Cyanobenzylsulfonyl chloride, 4-cyanobenzylsulphonyl chloride, UKKQISHRHXSEGI-UHFFFAOYSA-N, (4-Cyanophenyl)methanesulphonyl chloride, s10027, (4-cyano-phenyl)methanesulfonyl chloride, (4-cyano-phenyl)-methanesulfonyl chloride, 1-(4-cyanophenyl)methanesulfonyl chloride