CAS 1851-09-8 appears in our catalog under these names: 4-Chlorophenylsulfonylacetonitrile, 98%, 2-((4-Chlorophenyl)sulfonyl)acetonitrile 98%, 4-Chlorobenzenesulfonylacetonitrile, 95%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 5g, 25g, 1g, 250mg.
2-(4-chlorophenyl)sulfonylacetonitrile (CAS 1851-09-8) is a chemical compound with the molecular formula C8H6ClNO2S and a molecular weight of 215.66 g/mol. IUPAC name: 2-(4-chlorophenyl)sulfonylacetonitrile. InChIKey: HAQGVGPNKGGSMK-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2S |
|---|---|
| Molecular weight | 215.66 g/mol |
| IUPAC name | 2-(4-chlorophenyl)sulfonylacetonitrile |
| InChIKey | HAQGVGPNKGGSMK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)CC#N)Cl |
Computed by PubChem (NCBI)