Products 51045-34-2
CAS 51045-34-2 appears in our catalog under these names: (2-Cyanophenyl)methanesulfonyl chloride, 96%, (2-Cyanophenyl)methanesulfonyl chloride, 97%, (2-Cyanophenyl)methanesulfonyl chloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 10g, 5g, 25g, 100mg.
(2-cyanophenyl)methanesulfonyl chloride (CAS 51045-34-2) is a chemical compound with the molecular formula C8H6ClNO2S and a molecular weight of 215.66 g/mol. IUPAC name: (2-cyanophenyl)methanesulfonyl chloride. InChIKey: OJOPRZBXIJOTKB-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2S |
|---|---|
| Molecular weight | 215.66 g/mol |
| IUPAC name | (2-cyanophenyl)methanesulfonyl chloride |
| InChIKey | OJOPRZBXIJOTKB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CS(=O)(=O)Cl)C#N |
Computed by PubChem (NCBI)