CAS 403860-08-2 appears in our catalog under these names: Methyl 2-chloro-4H-thieno(3,2-b)pyrrole-5-carboxylate, 97%, Methyl 2-chloro-4H-thieno(3,2-b)pyrrole-5-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
Methyl 2-chloro-4H-thieno[3,2-b]pyrrole-5-carboxylate (CAS 403860-08-2) is a chemical compound with the molecular formula C8H6ClNO2S and a molecular weight of 215.66 g/mol. IUPAC name: methyl 2-chloro-4H-thieno[3,2-b]pyrrole-5-carboxylate. InChIKey: QETCAFYGBABJCO-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2S |
|---|---|
| Molecular weight | 215.66 g/mol |
| IUPAC name | methyl 2-chloro-4H-thieno[3,2-b]pyrrole-5-carboxylate |
| InChIKey | QETCAFYGBABJCO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(N1)C=C(S2)Cl |
Computed by PubChem (NCBI)