Products 1094209-33-2
CAS 1094209-33-2 appears in our catalog under these names: 1H-Indole-5-sulfonyl chloride, 97%, 1H-Indole-5-sulfonyl chloride 97%, 1H-Indole-5-sulfonyl chloride, 95%, 95%, 1H-INDOLE-5-SULFONYL CHLORIDE, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 10g, 1g, 100mg.
1H-indole-5-sulfonyl chloride (CAS 1094209-33-2) is a chemical compound with the molecular formula C8H6ClNO2S and a molecular weight of 215.66 g/mol. IUPAC name: 1H-indole-5-sulfonyl chloride. InChIKey: MZGMZFOGQIBZLB-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2S |
|---|---|
| Molecular weight | 215.66 g/mol |
| IUPAC name | 1H-indole-5-sulfonyl chloride |
| InChIKey | MZGMZFOGQIBZLB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN2)C=C1S(=O)(=O)Cl |
Computed by PubChem (NCBI)