CAS 403860-07-1 is the registry number for Methyl 3-chloro-4H-thieno[3,2-b]pyrrole-5-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-chloro-4H-thieno[3,2-b]pyrrole-5-carboxylate (CAS 403860-07-1) is a chemical compound with the molecular formula C8H6ClNO2S and a molecular weight of 215.66 g/mol. IUPAC name: methyl 3-chloro-4H-thieno[3,2-b]pyrrole-5-carboxylate. InChIKey: BEMUCZOBFBMGJZ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2S |
|---|---|
| Molecular weight | 215.66 g/mol |
| IUPAC name | methyl 3-chloro-4H-thieno[3,2-b]pyrrole-5-carboxylate |
| InChIKey | BEMUCZOBFBMGJZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(N1)C(=CS2)Cl |
Computed by PubChem (NCBI)