CAS 886578-15-0 appears in our catalog under these names: 1H-Indole-3-sulfonyl chloride, 95%, 1H-indole-3-sulfonyl chloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
1H-indole-3-sulfonyl chloride (CAS 886578-15-0) is a chemical compound with the molecular formula C8H6ClNO2S and a molecular weight of 215.66 g/mol. IUPAC name: 1H-indole-3-sulfonyl chloride. InChIKey: QGONQZDATSXDKK-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2S |
|---|---|
| Molecular weight | 215.66 g/mol |
| IUPAC name | 1H-indole-3-sulfonyl chloride |
| InChIKey | QGONQZDATSXDKK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)