Products 56105-99-8
CAS 56105-99-8 appears in our catalog under these names: (4-Cyanophenyl)methanesulfonyl chloride, 96%, (4-Cyanophenyl)methanesulfonyl Chloride, (4-Cyanophenyl)methanesulfonyl chloride 98%, (4-Cyanophenyl)methanesulfonyl chloride, 98%, 98%, (4-Cyanophenyl)methanesulfonyl chloride, 98%. Offered by: Combi-blocks, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 25g, 500mg, 100mg.
(4-cyanophenyl)methanesulfonyl chloride (CAS 56105-99-8) is a chemical compound with the molecular formula C8H6ClNO2S and a molecular weight of 215.66 g/mol. IUPAC name: (4-cyanophenyl)methanesulfonyl chloride. InChIKey: UKKQISHRHXSEGI-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2S |
|---|---|
| Molecular weight | 215.66 g/mol |
| IUPAC name | (4-cyanophenyl)methanesulfonyl chloride |
| InChIKey | UKKQISHRHXSEGI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CS(=O)(=O)Cl)C#N |
Computed by PubChem (NCBI)
Synonyms:
(4-cyanophenyl)methanesulfonyl chloride, (4-Cyanophenyl)methanesulfonylchloride, 4-Cyanobenzylsulfonyl chloride, 4-cyanobenzylsulphonyl chloride, UKKQISHRHXSEGI-UHFFFAOYSA-N, (4-Cyanophenyl)methanesulphonyl chloride, s10027, (4-cyano-phenyl)methanesulfonyl chloride, (4-cyano-phenyl)-methanesulfonyl chloride, 1-(4-cyanophenyl)methanesulfonyl chloride