CAS 56106-01-5 appears in our catalog under these names: (3-Cyanophenyl)methanesulfonyl chloride, 98%, 3-Cyanobenzylsulfonyl chloride, 97% , (3-Cyanophenyl)methanesulfonyl chloride 98%, (3-Cyanophenyl)methanesulfonyl chloride, 98%, 98%. Offered by: Combi-blocks, Thermo Scientific, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 100mg, 250mg.
(3-cyanophenyl)methanesulfonyl chloride (CAS 56106-01-5) is a chemical compound with the molecular formula C8H6ClNO2S and a molecular weight of 215.66 g/mol. IUPAC name: (3-cyanophenyl)methanesulfonyl chloride. InChIKey: YNWYDZBBHOWDAE-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2S |
|---|---|
| Molecular weight | 215.66 g/mol |
| IUPAC name | (3-cyanophenyl)methanesulfonyl chloride |
| InChIKey | YNWYDZBBHOWDAE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C#N)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)