cas: 2121512-88-5 — see every product listed under this CAS number, including other names
(4-Fluoro-2,3-dimethoxyphenyl)boronic acid, 98%, 98% (CAS 2121512-88-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K047-100mg |
| cas | 2121512-88-5 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 630.80 Pln | |
| Chemat | 250mg | 1010.00 Pln | |
| Chemat | 1g | 1955.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4-fluoro-2,3-dimethoxyphenyl)boronic acid (CAS 2121512-88-5) is a chemical compound with the molecular formula C8H10BFO4 and a molecular weight of 199.97 g/mol. IUPAC name: (4-fluoro-2,3-dimethoxyphenyl)boronic acid. InChIKey: WBDNGHQQERYTBH-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO4 |
|---|---|
| Molecular weight | 199.97 g/mol |
| IUPAC name | (4-fluoro-2,3-dimethoxyphenyl)boronic acid |
| InChIKey | WBDNGHQQERYTBH-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)OC)OC)(O)O |
Computed by PubChem (NCBI)