2,3-Dimethoxy-4-fluorophenylboronic acid, 98%
cas: 2121512-88-5 — see every product listed under this CAS number, including other names
2,3-Dimethoxy-4-fluorophenylboronic acid, 98% (CAS 2121512-88-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627642-100MG |
| cas | 2121512-88-5 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 784.12 Pln | |
| Fluorochem | 250mg | 1263.11 Pln | |
| Fluorochem | 500mg | 1981.61 Pln | |
| Fluorochem | 1g | 2471.02 Pln | |
| Fluorochem | 5g | 8687.58 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(4-fluoro-2,3-dimethoxyphenyl)boronic acid (CAS 2121512-88-5) is a chemical compound with the molecular formula C8H10BFO4 and a molecular weight of 199.97 g/mol. IUPAC name: (4-fluoro-2,3-dimethoxyphenyl)boronic acid. InChIKey: WBDNGHQQERYTBH-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO4 |
|---|---|
| Molecular weight | 199.97 g/mol |
| IUPAC name | (4-fluoro-2,3-dimethoxyphenyl)boronic acid |
| InChIKey | WBDNGHQQERYTBH-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)OC)OC)(O)O |
Computed by PubChem (NCBI)