cas: 169126-63-0 — see every product listed under this CAS number, including other names
(5,5,8,8-Tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)boronic acid, 98%, 98% (CAS 169126-63-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112YHL-100mg |
| cas | 169126-63-0 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 717.20 Pln | |
| Chemat | 10g | 1331.60 Pln | |
| Chemat | 25g | 2622.80 Pln | |
| Chemat | 100g | 9160.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)boronic acid (CAS 169126-63-0) is a chemical compound with the molecular formula C14H21BO2 and a molecular weight of 232.13 g/mol. IUPAC name: (5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)boronic acid. InChIKey: NXBNRLONOXGRCQ-UHFFFAOYSA-N.
| Molecular formula | C14H21BO2 |
|---|---|
| Molecular weight | 232.13 g/mol |
| IUPAC name | (5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)boronic acid |
| InChIKey | NXBNRLONOXGRCQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C(CCC2(C)C)(C)C)(O)O |
Computed by PubChem (NCBI)