cas: 488713-34-4 — see every product listed under this CAS number, including other names
(5-FLUORO-2-(METHOXYMETHOXY)PHENYL)BORONIC ACID PINACOL ESTER, 95% (CAS 488713-34-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F513746-1G |
| cas | 488713-34-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 294.71 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
[5-fluoro-2-(methoxymethoxy)phenyl]boronic acid (CAS 488713-34-4) is a chemical compound with the molecular formula C8H10BFO4 and a molecular weight of 199.97 g/mol. IUPAC name: [5-fluoro-2-(methoxymethoxy)phenyl]boronic acid. InChIKey: AMHIODVERFMLIU-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO4 |
|---|---|
| Molecular weight | 199.97 g/mol |
| IUPAC name | [5-fluoro-2-(methoxymethoxy)phenyl]boronic acid |
| InChIKey | AMHIODVERFMLIU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)OCOC)(O)O |
Computed by PubChem (NCBI)