(5-Fluoro-3-formyl-2-methoxyphenyl)boronic acid, 95+%
cas: 1072951-73-5 — see every product listed under this CAS number, including other names
(5-Fluoro-3-formyl-2-methoxyphenyl)boronic acid, 95+% (CAS 1072951-73-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A379142-250mg |
| cas | 1072951-73-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 654.06 Pln | |
| Ambeed | 5g | 2372.88 Pln | |
| BLDpharm | 100mg | 269.93 Pln | |
| BLDpharm | 250mg | 325.47 Pln | |
| BLDpharm | 1g | 697.56 Pln | |
| BLDpharm | 5g | 2552.46 Pln | |
| Fluorochem | 100mg | 404.04 Pln | |
| Fluorochem | 250mg | 638.33 Pln | |
| Fluorochem | 1g | 1554.68 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
(5-fluoro-3-formyl-2-methoxyphenyl)boronic acid (CAS 1072951-73-5) is a chemical compound with the molecular formula C8H8BFO4 and a molecular weight of 197.96 g/mol. IUPAC name: (5-fluoro-3-formyl-2-methoxyphenyl)boronic acid. InChIKey: NRUGZYHSZKKPJR-UHFFFAOYSA-N.
| Molecular formula | C8H8BFO4 |
|---|---|
| Molecular weight | 197.96 g/mol |
| IUPAC name | (5-fluoro-3-formyl-2-methoxyphenyl)boronic acid |
| InChIKey | NRUGZYHSZKKPJR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OC)C=O)F)(O)O |
Computed by PubChem (NCBI)