CAS 850568-05-7 appears in our catalog under these names: 2-Methoxycarbonyl-5-fluorophenylboronic acid 98%, 2-Methoxycarbonyl-5-fluorophenylboronic acid, 98%, 98%, 2-Methoxycarbonyl-5-fluorophenylboronic acid, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
(5-fluoro-2-methoxycarbonylphenyl)boronic acid (CAS 850568-05-7) is a chemical compound with the molecular formula C8H8BFO4 and a molecular weight of 197.96 g/mol. IUPAC name: (5-fluoro-2-methoxycarbonylphenyl)boronic acid. InChIKey: CHDCMVDJRAQCTJ-UHFFFAOYSA-N.
| Molecular formula | C8H8BFO4 |
|---|---|
| Molecular weight | 197.96 g/mol |
| IUPAC name | (5-fluoro-2-methoxycarbonylphenyl)boronic acid |
| InChIKey | CHDCMVDJRAQCTJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)C(=O)OC)(O)O |
Computed by PubChem (NCBI)