cas: 22837-75-8 — see every product listed under this CAS number, including other names
(E)-Methyl 3-([1,1'-biphenyl]-4-yl)acrylate, 98%, 98% (CAS 22837-75-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I5HV-100mg |
| cas | 22837-75-8 |
| size | 100mg |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 362.00 Pln | |
| Chemat | 250mg | 558.80 Pln | |
| Chemat | 1g | 1403.60 Pln | |
| Chemat | 5g | 4768.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl (E)-3-(4-phenylphenyl)prop-2-enoate (CAS 22837-75-8) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: methyl (E)-3-(4-phenylphenyl)prop-2-enoate. InChIKey: UHUGJJAYJFINJA-FMIVXFBMSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | methyl (E)-3-(4-phenylphenyl)prop-2-enoate |
| InChIKey | UHUGJJAYJFINJA-FMIVXFBMSA-N |
| SMILES | COC(=O)/C=C/C1=CC=C(C=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)