Products 432538-73-3
CAS 432538-73-3 is the registry number for 7-Hydroxy-4-phenyl-3,4-dihydronaphthalen-1(2h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
7-hydroxy-4-phenyl-3,4-dihydro-2H-naphthalen-1-one (CAS 432538-73-3) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: 7-hydroxy-4-phenyl-3,4-dihydro-2H-naphthalen-1-one. InChIKey: IHHCACIVDBWLHA-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 7-hydroxy-4-phenyl-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | IHHCACIVDBWLHA-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C1C3=CC=CC=C3)C=CC(=C2)O |
Computed by PubChem (NCBI)