(R)-1-(2-Bromo-4-chlorophenyl)-2,2,2-trifluoroethanol, 97%
cas: 1033805-25-2 — see every product listed under this CAS number, including other names
(R)-1-(2-Bromo-4-chlorophenyl)-2,2,2-trifluoroethanol, 97% (CAS 1033805-25-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg, 500mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A644970-10g |
| cas | 1033805-25-2 |
| size | 10g |
| availability | Synthetic Items: 0g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 16598.89 Pln | |
| AmBeed | 1g | 7582.54 Pln | |
| AmBeed | 5g | 9991.24 Pln | |
| Fluorochem | 100mg | 763.29 Pln | |
| Fluorochem | 250mg | 1450.55 Pln | |
| Fluorochem | 500mg | 2372.10 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(1R)-1-(2-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol (CAS 1033805-25-2) is a chemical compound with the molecular formula C8H5BrClF3O and a molecular weight of 289.47 g/mol. IUPAC name: (1R)-1-(2-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol. InChIKey: KNGKJEAJYVSAIV-SSDOTTSWSA-N.
| Molecular formula | C8H5BrClF3O |
|---|---|
| Molecular weight | 289.47 g/mol |
| IUPAC name | (1R)-1-(2-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol |
| InChIKey | KNGKJEAJYVSAIV-SSDOTTSWSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Br)[C@H](C(F)(F)F)O |
Computed by PubChem (NCBI)
Synonyms:
(R)-1-(2-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol, (1r)-1-(2-bromo-4-chlorophenyl)-2,2,2-trifluoroethan-1-ol, (R)-1-(2-Bromo-4-chlorophenyl)-2,2,2-trifluo, (1R)-1-(2-bromo-4-chloro-phenyl)-2,2,2-trifluoro-ethanol, (R)-1-(2-bromo-4-chlorophenyl)-2,2,2-trifluoroethan-1-ol, (R)-1-(2-Bromo-4-chlorophenyl)-2,2,2-trifluoroethane-1-ol