CAS 1508437-73-7 appears in our catalog under these names: 1-(2-Bromo-4-chloro-phenyl)-2,2,2-trifluoro-ethanol, 95%, 1-(2-Bromo-4-chloro-phenyl)-2,2,2-trifluoro-ethanol, 97%, 1-(2-bromo-4-chlorophenyl)-2,2,2-trifluoroethan-1-ol, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 10g, 5g, 1g, 250mg, 500mg.
1-(2-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol (CAS 1508437-73-7) is a chemical compound with the molecular formula C8H5BrClF3O and a molecular weight of 289.47 g/mol. IUPAC name: 1-(2-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol. InChIKey: KNGKJEAJYVSAIV-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3O |
|---|---|
| Molecular weight | 289.47 g/mol |
| IUPAC name | 1-(2-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol |
| InChIKey | KNGKJEAJYVSAIV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Br)C(C(F)(F)F)O |
Computed by PubChem (NCBI)