Products 1393442-60-8

CAS 1393442-60-8 is the registry number for 5-Bromo-2-(trifluoromethoxy)benzyl chloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 25g, 5g, 250mg.

Structural formula: {0} (CAS {1})

4-bromo-2-(chloromethyl)-1-(trifluoromethoxy)benzene (CAS 1393442-60-8) is a chemical compound with the molecular formula C8H5BrClF3O and a molecular weight of 289.47 g/mol. IUPAC name: 4-bromo-2-(chloromethyl)-1-(trifluoromethoxy)benzene. InChIKey: CBJUTDFJHJUDSM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5BrClF3O
Molecular weight289.47 g/mol
IUPAC name4-bromo-2-(chloromethyl)-1-(trifluoromethoxy)benzene
InChIKeyCBJUTDFJHJUDSM-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Br)CCl)OC(F)(F)F

Computed by PubChem (NCBI)