Products 1261606-06-7
CAS 1261606-06-7 appears in our catalog under these names: 4-Chloro-2-(trifluoromethoxy)benzyl bromide, 95%, 1-(Bromomethyl)-4-chloro-2-(trifluoromethoxy)benzene 95+%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
1-(bromomethyl)-4-chloro-2-(trifluoromethoxy)benzene (CAS 1261606-06-7) is a chemical compound with the molecular formula C8H5BrClF3O and a molecular weight of 289.47 g/mol. IUPAC name: 1-(bromomethyl)-4-chloro-2-(trifluoromethoxy)benzene. InChIKey: MJFOCXUYPQIXDL-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3O |
|---|---|
| Molecular weight | 289.47 g/mol |
| IUPAC name | 1-(bromomethyl)-4-chloro-2-(trifluoromethoxy)benzene |
| InChIKey | MJFOCXUYPQIXDL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)OC(F)(F)F)CBr |
Computed by PubChem (NCBI)