Products 1809161-59-8
CAS 1809161-59-8 appears in our catalog under these names: 4-Bromo-2-chloro-5-(trifluoromethyl)benzyl alcohol, 95%, Benzenemethanol, 4-bromo-2-chloro-5-(trifluoromethyl)-, ≥95%, ≥95%, 4-Bromo-2-chloro-5-(trifluoromethyl)benzyl alcohol. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.
[4-bromo-2-chloro-5-(trifluoromethyl)phenyl]methanol (CAS 1809161-59-8) is a chemical compound with the molecular formula C8H5BrClF3O and a molecular weight of 289.47 g/mol. IUPAC name: [4-bromo-2-chloro-5-(trifluoromethyl)phenyl]methanol. InChIKey: JOZJQPFGMLSSSR-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3O |
|---|---|
| Molecular weight | 289.47 g/mol |
| IUPAC name | [4-bromo-2-chloro-5-(trifluoromethyl)phenyl]methanol |
| InChIKey | JOZJQPFGMLSSSR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1C(F)(F)F)Br)Cl)CO |
Computed by PubChem (NCBI)