CAS 2166902-23-2 is the registry number for 1-Bromo-5-chloro-2-methoxy-4-(trifluoromethyl)benzene, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
1-bromo-5-chloro-2-methoxy-4-(trifluoromethyl)benzene (CAS 2166902-23-2) is a chemical compound with the molecular formula C8H5BrClF3O and a molecular weight of 289.47 g/mol. IUPAC name: 1-bromo-5-chloro-2-methoxy-4-(trifluoromethyl)benzene. InChIKey: LRAQNLMPLBZRIZ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3O |
|---|---|
| Molecular weight | 289.47 g/mol |
| IUPAC name | 1-bromo-5-chloro-2-methoxy-4-(trifluoromethyl)benzene |
| InChIKey | LRAQNLMPLBZRIZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(F)(F)F)Cl)Br |
Computed by PubChem (NCBI)