CAS 261763-18-2 appears in our catalog under these names: 4-(Bromomethyl)-2-chloro-1-(trifluoromethoxy)benzene, 98%, 3-Chloro-4-(trifluoromethoxy)benzyl bromide, 97%, 3-Chloro-4-(trifluoromethoxy)benzyl bromide, 98%. Offered by: Ambeed, Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
4-(bromomethyl)-2-chloro-1-(trifluoromethoxy)benzene (CAS 261763-18-2) is a chemical compound with the molecular formula C8H5BrClF3O and a molecular weight of 289.47 g/mol. IUPAC name: 4-(bromomethyl)-2-chloro-1-(trifluoromethoxy)benzene. InChIKey: YTXRMMJPEBWDPE-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3O |
|---|---|
| Molecular weight | 289.47 g/mol |
| IUPAC name | 4-(bromomethyl)-2-chloro-1-(trifluoromethoxy)benzene |
| InChIKey | YTXRMMJPEBWDPE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CBr)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)