Products 1261822-79-0
CAS 1261822-79-0 appears in our catalog under these names: 2-Chloro-6-(trifluoromethoxy)benzyl bromide, 95%, 2-Chloro-6-(trifluoromethoxy)benzyl bromide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2-(bromomethyl)-1-chloro-3-(trifluoromethoxy)benzene (CAS 1261822-79-0) is a chemical compound with the molecular formula C8H5BrClF3O and a molecular weight of 289.47 g/mol. IUPAC name: 2-(bromomethyl)-1-chloro-3-(trifluoromethoxy)benzene. InChIKey: COHYTMOYGPWHHN-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3O |
|---|---|
| Molecular weight | 289.47 g/mol |
| IUPAC name | 2-(bromomethyl)-1-chloro-3-(trifluoromethoxy)benzene |
| InChIKey | COHYTMOYGPWHHN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CBr)OC(F)(F)F |
Computed by PubChem (NCBI)