Products 1934433-57-4
CAS 1934433-57-4 is the registry number for 1-Bromo-2-chloro-4-(2,2,2-trifluoroethoxy)benzene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
1-bromo-2-chloro-4-(2,2,2-trifluoroethoxy)benzene (CAS 1934433-57-4) is a chemical compound with the molecular formula C8H5BrClF3O and a molecular weight of 289.47 g/mol. IUPAC name: 1-bromo-2-chloro-4-(2,2,2-trifluoroethoxy)benzene. InChIKey: TYFSHXLSXJFHDV-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3O |
|---|---|
| Molecular weight | 289.47 g/mol |
| IUPAC name | 1-bromo-2-chloro-4-(2,2,2-trifluoroethoxy)benzene |
| InChIKey | TYFSHXLSXJFHDV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OCC(F)(F)F)Cl)Br |
Computed by PubChem (NCBI)