cas: 82572-04-1 — see every product listed under this CAS number, including other names
(R)-1-(Naphthalen-1-yl)ethanamine hydrochloride 98% (CAS 82572-04-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A196008-100mg |
| cas | 82572-04-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 159.00 Pln | |
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 698.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A196008 |
(1R)-1-naphthalen-1-ylethanamine;hydrochloride (CAS 82572-04-1) is a chemical compound with the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. IUPAC name: (1R)-1-naphthalen-1-ylethanamine;hydrochloride. InChIKey: ZTNKTVBJMXQOBQ-SBSPUUFOSA-N.
| Molecular formula | C12H14ClN |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | (1R)-1-naphthalen-1-ylethanamine;hydrochloride |
| InChIKey | ZTNKTVBJMXQOBQ-SBSPUUFOSA-N |
| SMILES | C[C@H](C1=CC=CC2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)