cas: 82572-04-1 — see every product listed under this CAS number, including other names
(R)-1-(Naphthalen-1-yl)ethanamine hydrochloride, 98%, 98% (CAS 82572-04-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114C5A-10g |
| cas | 82572-04-1 |
| size | 10g |
| availability | 60g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 851.60 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 525.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(1R)-1-naphthalen-1-ylethanamine;hydrochloride (CAS 82572-04-1) is a chemical compound with the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. IUPAC name: (1R)-1-naphthalen-1-ylethanamine;hydrochloride. InChIKey: ZTNKTVBJMXQOBQ-SBSPUUFOSA-N.
| Molecular formula | C12H14ClN |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | (1R)-1-naphthalen-1-ylethanamine;hydrochloride |
| InChIKey | ZTNKTVBJMXQOBQ-SBSPUUFOSA-N |
| SMILES | C[C@H](C1=CC=CC2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)