cas: 67843-72-5 — see every product listed under this CAS number, including other names
(R)-3-(((Benzyloxy)carbonyl)amino)butanoic acid, 99%, 99% (CAS 67843-72-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 50g, 250g, 500g, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114VFB-10g |
| cas | 67843-72-5 |
| size | 10g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 131.60 Pln | |
| Chemat | 50g | 338.00 Pln | |
| Chemat | 250g | 1197.20 Pln | |
| Chemat | 500g | 2198.40 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 25g | 222.80 Pln | |
| Chemat | 100g | 544.40 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
(3R)-3-(phenylmethoxycarbonylamino)butanoic acid (CAS 67843-72-5) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: (3R)-3-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: HYWJKPFAIAWVHP-SECBINFHSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | (3R)-3-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | HYWJKPFAIAWVHP-SECBINFHSA-N |
| SMILES | C[C@H](CC(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)