cas: 67843-72-5 — see every product listed under this CAS number, including other names
Z-β-D-HomoAla-OH, 98.0% (CAS 67843-72-5) is a chemical reagent available from Chemat. Available pack sizes: 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W022446-5 g |
| cas | 67843-72-5 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 394.00 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
(3R)-3-(phenylmethoxycarbonylamino)butanoic acid (CAS 67843-72-5) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: (3R)-3-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: HYWJKPFAIAWVHP-SECBINFHSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | (3R)-3-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | HYWJKPFAIAWVHP-SECBINFHSA-N |
| SMILES | C[C@H](CC(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)