(R)-3-AMINO-4-(4-BROMOPHENYL)BUTANOIC ACID HYDROCHLORIDE, 97%
cas: 331763-73-6 — see every product listed under this CAS number, including other names
(R)-3-AMINO-4-(4-BROMOPHENYL)BUTANOIC ACID HYDROCHLORIDE, 97% (CAS 331763-73-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11I7FT-100mg |
| cas | 331763-73-6 |
| size | 100mg |
| availability | 10g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 309.20 Pln | |
| Chemat | 1g | 693.20 Pln | |
| Chemat | 5g | 3208.40 Pln | |
| Fluorochem | 100mg | 227.02 Pln | |
| Fluorochem | 250mg | 305.12 Pln | |
| Fluorochem | 1g | 732.05 Pln | |
| Fluorochem | 5g | 3330.10 Pln | |
| Fluorochem | 10g | 5964.58 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3R)-3-amino-4-(4-bromophenyl)butanoic acid;hydrochloride (CAS 331763-73-6) is a chemical compound with the molecular formula C10H13BrClNO2 and a molecular weight of 294.57 g/mol. IUPAC name: (3R)-3-amino-4-(4-bromophenyl)butanoic acid;hydrochloride. InChIKey: QMUGXLUXLGZZSC-SBSPUUFOSA-N.
| Molecular formula | C10H13BrClNO2 |
|---|---|
| Molecular weight | 294.57 g/mol |
| IUPAC name | (3R)-3-amino-4-(4-bromophenyl)butanoic acid;hydrochloride |
| InChIKey | QMUGXLUXLGZZSC-SBSPUUFOSA-N |
| SMILES | C1=CC(=CC=C1C[C@H](CC(=O)O)N)Br.Cl |
Computed by PubChem (NCBI)
Synonyms:
(3R)-3-amino-4-(4-bromophenyl)butanoic acid hydrochloride, (3R)-3-amino-4-(4-bromophenyl)butanoic acid;hydrochloride, (R)-3-Amino-4-(4-bromophenyl)-butanoic acid hydrochloride, 4-Bromo-D-beta-homophenylalanine hydrochloride, (R)-3-Amino-4-(4-bromophenyl)butyric acid hydrochloride, D-b-HomoPhe(4-Br)-OH.HCl, (R)-3-Amino-4-(4-bromophenyl)butanoicacidhydrochloride, H-D-beta-HPhe(4-Br)-OH HCl, (R)-3-Amino-4-(4-bromo-phenyl)-butyric acid hydrochloride, (3R)-3-Amino-4-(4-bromophenyl)butanoic acid--hydrogen chloride (1/1)