cas: 1270294-05-7 — see every product listed under this CAS number, including other names
(R)-5,7-Difluorochroman-4-ol, 99.98% (CAS 1270294-05-7) is a chemical reagent available from Chemat. Available pack sizes: 50 g, 500 mg, 10 g, 25 g, 1 g, 100 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W048541A-50 g |
| cas | 1270294-05-7 |
| size | 50 g |
| availability | In stock |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 50 g | 3793.40 Pln | |
| MedChemExpress | 500 mg | 254.68 Pln | |
| MedChemExpress | 10 g | 1211.34 Pln | |
| MedChemExpress | 25 g | 2302.68 Pln | |
| MedChemExpress | 1 g | 333.62 Pln | |
| MedChemExpress | 100 g | 6008.59 Pln | |
| MedChemExpress | 5 g | 770.16 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.98% |
(4R)-5,7-difluoro-3,4-dihydro-2H-chromen-4-ol (CAS 1270294-05-7) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: (4R)-5,7-difluoro-3,4-dihydro-2H-chromen-4-ol. InChIKey: HGTYMLFMXKYIQW-SSDOTTSWSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | (4R)-5,7-difluoro-3,4-dihydro-2H-chromen-4-ol |
| InChIKey | HGTYMLFMXKYIQW-SSDOTTSWSA-N |
| SMILES | C1COC2=C([C@@H]1O)C(=CC(=C2)F)F |
Computed by PubChem (NCBI)